About 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea
1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea (PubChem CID 2819085) has the molecular formula C14H20N2OS2
and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea.
Molecular Properties
| Compound Name | 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea |
| PubChem CID | 2819085 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C14H20N2OS2/c1-2-3-8-15-14(17)16-12-6-4-11(5-7-12)13-18-9-10-19-13/h4-7,13H,2-3,8-10H2,1H3,(H2,15,16,17) |
| InChIKey | QHVVWGUSILODIM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea?
The IUPAC name of 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea (CID 2819085) is 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea.
What is the SMILES notation for 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea?
The canonical SMILES for 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea is CCCCNC(=O)Nc1ccc(C2SCCS2)cc1.
What is the InChIKey of 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea?
The InChIKey is QHVVWGUSILODIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2OS2/c1-2-3-8-15-14(17)16-12-6-4-11(5-7-12)13-18-9-10-19-13/h4-7,13H,2-3,8-10H2,1H3,(H2,15,16,17).
What are the key properties of 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea?
1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea has a molecular weight of 296.46 g/mol, XLogP of 4.09, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[4-(1,3-dithiolan-2-yl)phenyl]urea is sourced from PubChem (CID 2819085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).