About (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one
(3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one (PubChem CID 2819311) has the molecular formula C16H13FN2O3S
and a molecular weight of 332.36 g/mol. Its IUPAC name is (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one.
Molecular Properties
| Compound Name | (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| PubChem CID | 2819311 |
| Molecular Formula | C16H13FN2O3S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| SMILES | CN1c2ccccc2C(=O)/C(=C\Nc2ccc(F)cc2)S1(=O)=O |
| InChI | InChI=1S/C16H13FN2O3S/c1-19-14-5-3-2-4-13(14)16(20)15(23(19,21)22)10-18-12-8-6-11(17)7-9-12/h2-10,18H,1H3/b15-10+ |
| InChIKey | MZUGOPKOENUTFX-XNTDXEJSSA-N |
| XLogP | 2.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
The IUPAC name of (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one (CID 2819311) is (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one.
What is the SMILES notation for (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
The canonical SMILES for (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one is CN1c2ccccc2C(=O)/C(=C\Nc2ccc(F)cc2)S1(=O)=O.
What is the InChIKey of (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
The InChIKey is MZUGOPKOENUTFX-XNTDXEJSSA-N. The full InChI is InChI=1S/C16H13FN2O3S/c1-19-14-5-3-2-4-13(14)16(20)15(23(19,21)22)10-18-12-8-6-11(17)7-9-12/h2-10,18H,1H3/b15-10+.
What are the key properties of (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one?
(3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one has a molecular weight of 332.36 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(4-fluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one is sourced from PubChem (CID 2819311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).