C16H12F2N2O3S — CID 2819314
(3E)-3-[(2,4-difluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one (PubChem CID 2819314) has the molecular formula C16H12F2N2O3S and a molecular weight of 350.35 g/mol. Its IUPAC name is (3E)-3-[(2,4-difluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one.
| Compound Name | (3E)-3-[(2,4-difluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
|---|---|
| PubChem CID | 2819314 |
| Molecular Formula | C16H12F2N2O3S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (3E)-3-[(2,4-difluoroanilino)methylidene]-1-methyl-2,2-dioxo-2lambda6,1-benzothiazin-4-one |
| SMILES | CN1c2ccccc2C(=O)/C(=C\Nc2ccc(F)cc2F)S1(=O)=O |
| InChI | InChI=1S/C16H12F2N2O3S/c1-20-14-5-3-2-4-11(14)16(21)15(24(20,22)23)9-19-13-7-6-10(17)8-12(13)18/h2-9,19H,1H3/b15-9+ |
| InChIKey | WHVRTESNCFSSBK-OQLLNIDSSA-N |
| XLogP | 2.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|