About 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea
1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea (PubChem CID 2820006) has the molecular formula C14H13Cl3N2O3S2
and a molecular weight of 427.76 g/mol. Its IUPAC name is 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea |
| PubChem CID | 2820006 |
| Molecular Formula | C14H13Cl3N2O3S2 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 425.94 |
| IUPAC Name | 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea |
| SMILES | CC(C)S(=O)(=O)c1csc(NC(=O)Nc2cc(Cl)ccc2Cl)c1Cl |
| InChI | InChI=1S/C14H13Cl3N2O3S2/c1-7(2)24(21,22)11-6-23-13(12(11)17)19-14(20)18-10-5-8(15)3-4-9(10)16/h3-7H,1-2H3,(H2,18,19,20) |
| InChIKey | XUTQORNJLNKNLM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea?
The IUPAC name of 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea (CID 2820006) is 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea.
What is the SMILES notation for 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea?
The canonical SMILES for 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea is CC(C)S(=O)(=O)c1csc(NC(=O)Nc2cc(Cl)ccc2Cl)c1Cl.
What is the InChIKey of 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea?
The InChIKey is XUTQORNJLNKNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl3N2O3S2/c1-7(2)24(21,22)11-6-23-13(12(11)17)19-14(20)18-10-5-8(15)3-4-9(10)16/h3-7H,1-2H3,(H2,18,19,20).
What are the key properties of 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea?
1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea has a molecular weight of 427.76 g/mol, XLogP of 5.53, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)-3-(2,5-dichlorophenyl)urea is sourced from PubChem (CID 2820006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).