C13H19N3O2S2 — CID 2820172
4-hydroxy-3-methylsulfanyl-N-(propan-2-yldiazenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide (PubChem CID 2820172) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 4-hydroxy-3-methylsulfanyl-N-(propan-2-yldiazenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide.
| Compound Name | 4-hydroxy-3-methylsulfanyl-N-(propan-2-yldiazenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 2820172 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-hydroxy-3-methylsulfanyl-N-(propan-2-yldiazenyl)-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
| SMILES | CSc1sc(C(=O)N/N=N/C(C)C)c2c1C(O)CCC2 |
| InChI | InChI=1S/C13H19N3O2S2/c1-7(2)14-16-15-12(18)11-8-5-4-6-9(17)10(8)13(19-3)20-11/h7,9,17H,4-6H2,1-3H3,(H,14,15,18) |
| InChIKey | ONTOTEMQFKZJAG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|