C11H10N2S2 — CID 2820285
5-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-1H-pyrazole (PubChem CID 2820285) has the molecular formula C11H10N2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 5-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-1H-pyrazole.
| Compound Name | 5-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 2820285 |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 5-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-1H-pyrazole |
| SMILES | Cc1csc2sc(-c3ccn[nH]3)c(C)c12 |
| InChI | InChI=1S/C11H10N2S2/c1-6-5-14-11-9(6)7(2)10(15-11)8-3-4-12-13-8/h3-5H,1-2H3,(H,12,13) |
| InChIKey | GPOBCYOWVVZNOT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |