C14H14F3N3OS — CID 2820304
3-(dimethylamino)-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]prop-2-en-1-one (PubChem CID 2820304) has the molecular formula C14H14F3N3OS and a molecular weight of 329.35 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]prop-2-en-1-one.
| Compound Name | 3-(dimethylamino)-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 2820304 |
| Molecular Formula | C14H14F3N3OS |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-(dimethylamino)-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]prop-2-en-1-one |
| SMILES | CN(C)C=CC(=O)c1ccc(-c2cc(C(F)(F)F)n(C)n2)s1 |
| InChI | InChI=1S/C14H14F3N3OS/c1-19(2)7-6-10(21)12-5-4-11(22-12)9-8-13(14(15,16)17)20(3)18-9/h4-8H,1-3H3 |
| InChIKey | LAMXFJJORDIKCB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|