C13H14OS4 — CID 2820367
1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3,3-bis(methylsulfanyl)prop-2-en-1-one (PubChem CID 2820367) has the molecular formula C13H14OS4 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3,3-bis(methylsulfanyl)prop-2-en-1-one.
| Compound Name | 1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2820367 |
| Molecular Formula | C13H14OS4 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 1-(3,4-dimethylthieno[2,3-b]thiophen-5-yl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
| SMILES | CSC(=CC(=O)c1sc2scc(C)c2c1C)SC |
| InChI | InChI=1S/C13H14OS4/c1-7-6-17-13-11(7)8(2)12(18-13)9(14)5-10(15-3)16-4/h5-6H,1-4H3 |
| InChIKey | VIFRAQAYRDAJCR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|