C16H17ClN6O — CID 2820402
1-(3-chlorophenyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 2820402) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 2820402 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | Cc1cc(NNC(=O)Nc2cccc(Cl)c2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C16H17ClN6O/c1-9-7-13(19-15-14(9)10(2)22-23(15)3)20-21-16(24)18-12-6-4-5-11(17)8-12/h4-8H,1-3H3,(H,19,20)(H2,18,21,24) |
| InChIKey | SWTNQTGSOCFDMA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|