About (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one
(3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one (PubChem CID 2820480) has the molecular formula C13H11N3O3S2
and a molecular weight of 321.38 g/mol. Its IUPAC name is (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one.
Molecular Properties
| Compound Name | (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one |
| PubChem CID | 2820480 |
| Molecular Formula | C13H11N3O3S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one |
| SMILES | CN1c2ccsc2C(=O)/C(=C\Nc2ccccn2)S1(=O)=O |
| InChI | InChI=1S/C13H11N3O3S2/c1-16-9-5-7-20-13(9)12(17)10(21(16,18)19)8-15-11-4-2-3-6-14-11/h2-8H,1H3,(H,14,15)/b10-8+ |
| InChIKey | PCYCQYCROFJQEQ-CSKARUKUSA-N |
| XLogP | 2.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one?
The IUPAC name of (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one (CID 2820480) is (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one.
What is the SMILES notation for (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one?
The canonical SMILES for (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one is CN1c2ccsc2C(=O)/C(=C\Nc2ccccn2)S1(=O)=O.
What is the InChIKey of (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one?
The InChIKey is PCYCQYCROFJQEQ-CSKARUKUSA-N. The full InChI is InChI=1S/C13H11N3O3S2/c1-16-9-5-7-20-13(9)12(17)10(21(16,18)19)8-15-11-4-2-3-6-14-11/h2-8H,1H3,(H,14,15)/b10-8+.
What are the key properties of (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one?
(3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one has a molecular weight of 321.38 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-methyl-2,2-dioxo-3-[(pyridin-2-ylamino)methylidene]thieno[3,2-c]thiazin-4-one is sourced from PubChem (CID 2820480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).