About 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one
1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one (PubChem CID 2820510) has the molecular formula C14H10F3N3O3S2
and a molecular weight of 389.38 g/mol. Its IUPAC name is 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one.
Molecular Properties
| Compound Name | 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one |
| PubChem CID | 2820510 |
| Molecular Formula | C14H10F3N3O3S2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one |
| SMILES | CN1c2ccsc2C(=O)C(=NNc2cccc(C(F)(F)F)c2)S1(=O)=O |
| InChI | InChI=1S/C14H10F3N3O3S2/c1-20-10-5-6-24-12(10)11(21)13(25(20,22)23)19-18-9-4-2-3-8(7-9)14(15,16)17/h2-7,18H,1H3 |
| InChIKey | YJGJDDUKILWJHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one?
The IUPAC name of 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one (CID 2820510) is 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one.
What is the SMILES notation for 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one?
The canonical SMILES for 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one is CN1c2ccsc2C(=O)C(=NNc2cccc(C(F)(F)F)c2)S1(=O)=O.
What is the InChIKey of 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one?
The InChIKey is YJGJDDUKILWJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3O3S2/c1-20-10-5-6-24-12(10)11(21)13(25(20,22)23)19-18-9-4-2-3-8(7-9)14(15,16)17/h2-7,18H,1H3.
What are the key properties of 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one?
1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one has a molecular weight of 389.38 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,2-dioxo-3-[[3-(trifluoromethyl)phenyl]hydrazinylidene]thieno[3,2-c]thiazin-4-one is sourced from PubChem (CID 2820510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).