About methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate
methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate (PubChem CID 2820773) has the molecular formula C14H15NO3S2
and a molecular weight of 309.41 g/mol. Its IUPAC name is methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate |
| PubChem CID | 2820773 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1sc(C#N)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C14H15NO3S2/c1-14(2)4-8-10(6-15)20-13(12(8)9(16)5-14)19-7-11(17)18-3/h4-5,7H2,1-3H3 |
| InChIKey | XKNDUTULBQWLBI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate?
The IUPAC name of methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate (CID 2820773) is methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate.
What is the SMILES notation for methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate?
The canonical SMILES for methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate is COC(=O)CSc1sc(C#N)c2c1C(=O)CC(C)(C)C2.
What is the InChIKey of methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate?
The InChIKey is XKNDUTULBQWLBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3S2/c1-14(2)4-8-10(6-15)20-13(12(8)9(16)5-14)19-7-11(17)18-3/h4-5,7H2,1-3H3.
What are the key properties of methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate?
methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate has a molecular weight of 309.41 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-cyano-5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophen-1-yl)sulfanyl]acetate is sourced from PubChem (CID 2820773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).