C17H12F3N3O4S — CID 2820950
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]prop-2-enenitrile (PubChem CID 2820950) has the molecular formula C17H12F3N3O4S and a molecular weight of 411.36 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2820950 |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc2c(c1)OCCO2)S(=O)(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H12F3N3O4S/c18-17(19,20)11-1-4-16(23-9-11)28(24,25)13(8-21)10-22-12-2-3-14-15(7-12)27-6-5-26-14/h1-4,7,9-10,22H,5-6H2/b13-10+ |
| InChIKey | ABYGFMKZFCYZPV-JLHYYAGUSA-N |
| XLogP | 3.12 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|