About 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one
1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one (PubChem CID 2821018) has the molecular formula C20H22O4S3
and a molecular weight of 422.59 g/mol. Its IUPAC name is 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one.
Molecular Properties
| Compound Name | 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one |
| PubChem CID | 2821018 |
| Molecular Formula | C20H22O4S3 |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one |
| SMILES | CC(=O)c1sc(SCCS(=O)(=O)c2ccccc2)c2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C20H22O4S3/c1-13(21)18-15-11-20(2,3)12-16(22)17(15)19(26-18)25-9-10-27(23,24)14-7-5-4-6-8-14/h4-8H,9-12H2,1-3H3 |
| InChIKey | CTIKLOYSFXVSDR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one?
The IUPAC name of 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one (CID 2821018) is 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one.
What is the SMILES notation for 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one?
The canonical SMILES for 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one is CC(=O)c1sc(SCCS(=O)(=O)c2ccccc2)c2c1CC(C)(C)CC2=O.
What is the InChIKey of 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one?
The InChIKey is CTIKLOYSFXVSDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O4S3/c1-13(21)18-15-11-20(2,3)12-16(22)17(15)19(26-18)25-9-10-27(23,24)14-7-5-4-6-8-14/h4-8H,9-12H2,1-3H3.
What are the key properties of 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one?
1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one has a molecular weight of 422.59 g/mol, XLogP of 4.67, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3-[2-(benzenesulfonyl)ethylsulfanyl]-6,6-dimethyl-5,7-dihydro-2-benzothiophen-4-one is sourced from PubChem (CID 2821018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).