C18H19ClN2O3S — CID 2821278
2-[1-(4-chlorophenyl)ethylideneamino]oxy-N-[methyl-(4-methylphenyl)-oxo-lambda6-sulfanylidene]acetamide (PubChem CID 2821278) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)ethylideneamino]oxy-N-[methyl-(4-methylphenyl)-oxo-lambda6-sulfanylidene]acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)ethylideneamino]oxy-N-[methyl-(4-methylphenyl)-oxo-lambda6-sulfanylidene]acetamide |
|---|---|
| PubChem CID | 2821278 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-[1-(4-chlorophenyl)ethylideneamino]oxy-N-[methyl-(4-methylphenyl)-oxo-lambda6-sulfanylidene]acetamide |
| SMILES | CC(=NOCC(=O)N=S(C)(=O)c1ccc(C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O3S/c1-13-4-10-17(11-5-13)25(3,23)21-18(22)12-24-20-14(2)15-6-8-16(19)9-7-15/h4-11H,12H2,1-3H3 |
| InChIKey | OGKKUVPWFVWFBP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|