About [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone
[3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone (PubChem CID 2821373) has the molecular formula C16H12N2O2S
and a molecular weight of 296.35 g/mol. Its IUPAC name is [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone |
| PubChem CID | 2821373 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)n1ccc(-c2ccc3c(c2)CCO3)n1 |
| InChI | InChI=1S/C16H12N2O2S/c19-16(15-2-1-9-21-15)18-7-5-13(17-18)11-3-4-14-12(10-11)6-8-20-14/h1-5,7,9-10H,6,8H2 |
| InChIKey | XERSIMMVIAGYJH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone?
The IUPAC name of [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone (CID 2821373) is [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone is O=C(c1cccs1)n1ccc(-c2ccc3c(c2)CCO3)n1.
What is the InChIKey of [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone?
The InChIKey is XERSIMMVIAGYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2S/c19-16(15-2-1-9-21-15)18-7-5-13(17-18)11-3-4-14-12(10-11)6-8-20-14/h1-5,7,9-10H,6,8H2.
What are the key properties of [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone?
[3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone has a molecular weight of 296.35 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,3-dihydro-1-benzofuran-5-yl)pyrazol-1-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 2821373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).