C11H10Cl2N2O2S2 — CID 2821506
5-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 2821506) has the molecular formula C11H10Cl2N2O2S2 and a molecular weight of 337.25 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2821506 |
| Molecular Formula | C11H10Cl2N2O2S2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(CSCCOc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C11H10Cl2N2O2S2/c12-7-1-2-9(8(13)5-7)16-3-4-19-6-10-14-15-11(18)17-10/h1-2,5H,3-4,6H2,(H,15,18) |
| InChIKey | UHSRBUVMLVJEMW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|