C11H12N2O2S2 — CID 2821514
5-(2-phenoxyethylsulfanylmethyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 2821514) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-(2-phenoxyethylsulfanylmethyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-phenoxyethylsulfanylmethyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 2821514 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-(2-phenoxyethylsulfanylmethyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(CSCCOc2ccccc2)o1 |
| InChI | InChI=1S/C11H12N2O2S2/c16-11-13-12-10(15-11)8-17-7-6-14-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,13,16) |
| InChIKey | HVKUSVHBPOMZMT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|