C23H16Cl2F3NO2S — CID 2821573
S-[4-(trifluoromethyl)phenyl] 3-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzenecarbothioate (PubChem CID 2821573) has the molecular formula C23H16Cl2F3NO2S and a molecular weight of 498.35 g/mol. Its IUPAC name is S-[4-(trifluoromethyl)phenyl] 3-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzenecarbothioate.
| Compound Name | S-[4-(trifluoromethyl)phenyl] 3-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzenecarbothioate |
|---|---|
| PubChem CID | 2821573 |
| Molecular Formula | C23H16Cl2F3NO2S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | S-[4-(trifluoromethyl)phenyl] 3-[[1-(3,4-dichlorophenyl)ethylideneamino]oxymethyl]benzenecarbothioate |
| SMILES | CC(=NOCc1cccc(C(=O)Sc2ccc(C(F)(F)F)cc2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H16Cl2F3NO2S/c1-14(16-5-10-20(24)21(25)12-16)29-31-13-15-3-2-4-17(11-15)22(30)32-19-8-6-18(7-9-19)23(26,27)28/h2-12H,13H2,1H3 |
| InChIKey | GHKTVZOCFHAZKP-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|