About 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole
7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole (PubChem CID 2821617) has the molecular formula C10H10N4O4
and a molecular weight of 250.21 g/mol. Its IUPAC name is 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole |
| PubChem CID | 2821617 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1ccc(N2CCOCC2)c2nonc12 |
| InChI | InChI=1S/C10H10N4O4/c15-14(16)8-2-1-7(9-10(8)12-18-11-9)13-3-5-17-6-4-13/h1-2H,3-6H2 |
| InChIKey | PPMKRWMGEQTTQI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 94.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole?
The IUPAC name of 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole (CID 2821617) is 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole.
What is the SMILES notation for 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole?
The canonical SMILES for 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole is O=[N+]([O-])c1ccc(N2CCOCC2)c2nonc12.
What is the InChIKey of 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole?
The InChIKey is PPMKRWMGEQTTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O4/c15-14(16)8-2-1-7(9-10(8)12-18-11-9)13-3-5-17-6-4-13/h1-2H,3-6H2.
What are the key properties of 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole?
7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole has a molecular weight of 250.21 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-morpholin-4-yl-4-nitro-2,1,3-benzoxadiazole is sourced from PubChem (CID 2821617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).