About N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide
N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 2821731) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide |
| PubChem CID | 2821731 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)CCO2)C(C)(C)C |
| InChI | InChI=1S/C14H19NO2/c1-14(2,3)15(4)13(16)11-5-6-12-10(9-11)7-8-17-12/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | MQPHKOJPNZZQFE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide?
The IUPAC name of N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide (CID 2821731) is N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide.
What is the SMILES notation for N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide?
The canonical SMILES for N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide is CN(C(=O)c1ccc2c(c1)CCO2)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide?
The InChIKey is MQPHKOJPNZZQFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-14(2,3)15(4)13(16)11-5-6-12-10(9-11)7-8-17-12/h5-6,9H,7-8H2,1-4H3.
What are the key properties of N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide?
N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide has a molecular weight of 233.31 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-methyl-2,3-dihydro-1-benzofuran-5-carboxamide is sourced from PubChem (CID 2821731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).