About 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile
2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile (PubChem CID 2821800) has the molecular formula C8H5N3O2
and a molecular weight of 175.15 g/mol. Its IUPAC name is 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile.
Molecular Properties
| Compound Name | 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile |
| PubChem CID | 2821800 |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile |
| SMILES | N#CCOc1ccc2nonc2c1 |
| InChI | InChI=1S/C8H5N3O2/c9-3-4-12-6-1-2-7-8(5-6)11-13-10-7/h1-2,5H,4H2 |
| InChIKey | IDBSEFPLQLTMPI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile?
The IUPAC name of 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile (CID 2821800) is 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile.
What is the SMILES notation for 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile?
The canonical SMILES for 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile is N#CCOc1ccc2nonc2c1.
What is the InChIKey of 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile?
The InChIKey is IDBSEFPLQLTMPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2/c9-3-4-12-6-1-2-7-8(5-6)11-13-10-7/h1-2,5H,4H2.
What are the key properties of 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile?
2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile has a molecular weight of 175.15 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,1,3-benzoxadiazol-5-yloxy)acetonitrile is sourced from PubChem (CID 2821800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).