About 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole
5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole (PubChem CID 2821819) has the molecular formula C13H13N3OS
and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole |
| PubChem CID | 2821819 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole |
| SMILES | CC(C)(C)c1csc(-c2ccc3nonc3c2)n1 |
| InChI | InChI=1S/C13H13N3OS/c1-13(2,3)11-7-18-12(14-11)8-4-5-9-10(6-8)16-17-15-9/h4-7H,1-3H3 |
| InChIKey | FTSXESKEVGXXHL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole?
The IUPAC name of 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole (CID 2821819) is 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole.
What is the SMILES notation for 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole?
The canonical SMILES for 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole is CC(C)(C)c1csc(-c2ccc3nonc3c2)n1.
What is the InChIKey of 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole?
The InChIKey is FTSXESKEVGXXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3OS/c1-13(2,3)11-7-18-12(14-11)8-4-5-9-10(6-8)16-17-15-9/h4-7H,1-3H3.
What are the key properties of 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole?
5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole has a molecular weight of 259.33 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-tert-butyl-1,3-thiazol-2-yl)-2,1,3-benzoxadiazole is sourced from PubChem (CID 2821819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).