C16H7Cl2N3O2S2 — CID 2821826
S-(2,4-dichlorophenyl) 2-(2,1,3-benzoxadiazol-5-yl)-1,3-thiazole-4-carbothioate (PubChem CID 2821826) has the molecular formula C16H7Cl2N3O2S2 and a molecular weight of 408.29 g/mol. Its IUPAC name is S-(2,4-dichlorophenyl) 2-(2,1,3-benzoxadiazol-5-yl)-1,3-thiazole-4-carbothioate.
| Compound Name | S-(2,4-dichlorophenyl) 2-(2,1,3-benzoxadiazol-5-yl)-1,3-thiazole-4-carbothioate |
|---|---|
| PubChem CID | 2821826 |
| Molecular Formula | C16H7Cl2N3O2S2 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 406.94 |
| IUPAC Name | S-(2,4-dichlorophenyl) 2-(2,1,3-benzoxadiazol-5-yl)-1,3-thiazole-4-carbothioate |
| SMILES | O=C(Sc1ccc(Cl)cc1Cl)c1csc(-c2ccc3nonc3c2)n1 |
| InChI | InChI=1S/C16H7Cl2N3O2S2/c17-9-2-4-14(10(18)6-9)25-16(22)13-7-24-15(19-13)8-1-3-11-12(5-8)21-23-20-11/h1-7H |
| InChIKey | NYAAKSAOAKTYFH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|