About 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine
2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 2821857) has the molecular formula C13H17F3N4
and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 2821857 |
| Molecular Formula | C13H17F3N4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CN(C)c1cc(C(F)(F)F)nc2cc(C(C)(C)C)nn12 |
| InChI | InChI=1S/C13H17F3N4/c1-12(2,3)8-6-10-17-9(13(14,15)16)7-11(19(4)5)20(10)18-8/h6-7H,1-5H3 |
| InChIKey | GMDHLEIANIEZMT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine (CID 2821857) is 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine is CN(C)c1cc(C(F)(F)F)nc2cc(C(C)(C)C)nn12.
What is the InChIKey of 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is GMDHLEIANIEZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N4/c1-12(2,3)8-6-10-17-9(13(14,15)16)7-11(19(4)5)20(10)18-8/h6-7H,1-5H3.
What are the key properties of 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 286.30 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N,N-dimethyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 2821857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).