About 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione
3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione (PubChem CID 2822031) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione |
| PubChem CID | 2822031 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione |
| SMILES | Cc1csc(-c2cn(C(C)C)c(=O)n(Cc3ccccc3)c2=O)n1 |
| InChI | InChI=1S/C18H19N3O2S/c1-12(2)20-10-15(16-19-13(3)11-24-16)17(22)21(18(20)23)9-14-7-5-4-6-8-14/h4-8,10-12H,9H2,1-3H3 |
| InChIKey | LKYXJCHSNRKXFW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione?
The IUPAC name of 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione (CID 2822031) is 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione.
What is the SMILES notation for 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione?
The canonical SMILES for 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione is Cc1csc(-c2cn(C(C)C)c(=O)n(Cc3ccccc3)c2=O)n1.
What is the InChIKey of 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione?
The InChIKey is LKYXJCHSNRKXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-12(2)20-10-15(16-19-13(3)11-24-16)17(22)21(18(20)23)9-14-7-5-4-6-8-14/h4-8,10-12H,9H2,1-3H3.
What are the key properties of 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione?
3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione has a molecular weight of 341.44 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-(4-methyl-1,3-thiazol-2-yl)-1-propan-2-ylpyrimidine-2,4-dione is sourced from PubChem (CID 2822031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).