About 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one
4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one (PubChem CID 2822284) has the molecular formula C16H10Cl2F3NOS
and a molecular weight of 392.23 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one |
| PubChem CID | 2822284 |
| Molecular Formula | C16H10Cl2F3NOS |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(C(F)(F)F)cc2N1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H10Cl2F3NOS/c17-11-2-1-3-12(18)10(11)7-22-13-6-9(16(19,20)21)4-5-14(13)24-8-15(22)23/h1-6H,7-8H2 |
| InChIKey | LGLQXFOJZBFWKA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one?
The IUPAC name of 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one (CID 2822284) is 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one.
What is the SMILES notation for 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one?
The canonical SMILES for 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one is O=C1CSc2ccc(C(F)(F)F)cc2N1Cc1c(Cl)cccc1Cl.
What is the InChIKey of 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one?
The InChIKey is LGLQXFOJZBFWKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl2F3NOS/c17-11-2-1-3-12(18)10(11)7-22-13-6-9(16(19,20)21)4-5-14(13)24-8-15(22)23/h1-6H,7-8H2.
What are the key properties of 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one?
4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one has a molecular weight of 392.23 g/mol, XLogP of 5.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichlorophenyl)methyl]-6-(trifluoromethyl)-1,4-benzothiazin-3-one is sourced from PubChem (CID 2822284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).