C24H19N5OS — CID 2822417
2-[[4-methyl-5-[5-(2-phenylethynyl)-3-pyridinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 2822417) has the molecular formula C24H19N5OS and a molecular weight of 425.52 g/mol. Its IUPAC name is 2-[[4-methyl-5-[5-(2-phenylethynyl)-3-pyridinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[4-methyl-5-[5-(2-phenylethynyl)-3-pyridinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2822417 |
| Molecular Formula | C24H19N5OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-[[4-methyl-5-[5-(2-phenylethynyl)-3-pyridinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | Cn1c(SCC(=O)Nc2ccccc2)nnc1-c1cncc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H19N5OS/c1-29-23(20-14-19(15-25-16-20)13-12-18-8-4-2-5-9-18)27-28-24(29)31-17-22(30)26-21-10-6-3-7-11-21/h2-11,14-16H,17H2,1H3,(H,26,30) |
| InChIKey | AWYFJXJHLXDBRD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|