About 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide
5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide (PubChem CID 2822511) has the molecular formula C13H9ClO2S3
and a molecular weight of 328.87 g/mol. Its IUPAC name is 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide |
| PubChem CID | 2822511 |
| Molecular Formula | C13H9ClO2S3 |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C=C(CSc2cccs2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H9ClO2S3/c14-10-3-4-12-11(6-10)9(8-19(12,15)16)7-18-13-2-1-5-17-13/h1-6,8H,7H2 |
| InChIKey | PLAIFCKTAQKYRX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide?
The IUPAC name of 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide (CID 2822511) is 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide.
What is the SMILES notation for 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide?
The canonical SMILES for 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide is O=S1(=O)C=C(CSc2cccs2)c2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide?
The InChIKey is PLAIFCKTAQKYRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClO2S3/c14-10-3-4-12-11(6-10)9(8-19(12,15)16)7-18-13-2-1-5-17-13/h1-6,8H,7H2.
What are the key properties of 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide?
5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide has a molecular weight of 328.87 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(thiophen-2-ylsulfanylmethyl)-1-benzothiophene 1,1-dioxide is sourced from PubChem (CID 2822511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).