About [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate
[(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate (PubChem CID 2822570) has the molecular formula C22H25N3O2
and a molecular weight of 363.46 g/mol. Its IUPAC name is [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate.
Molecular Properties
| Compound Name | [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate |
| PubChem CID | 2822570 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)ON=C1CC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H25N3O2/c26-22(23-18-10-5-2-6-11-18)27-24-19-14-20-12-7-13-21(15-19)25(20)16-17-8-3-1-4-9-17/h1-6,8-11,20-21H,7,12-16H2,(H,23,26) |
| InChIKey | ADSVGKGPAPLVBG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate?
The IUPAC name of [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate (CID 2822570) is [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate.
What is the SMILES notation for [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate?
The canonical SMILES for [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate is O=C(Nc1ccccc1)ON=C1CC2CCCC(C1)N2Cc1ccccc1.
What is the InChIKey of [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate?
The InChIKey is ADSVGKGPAPLVBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O2/c26-22(23-18-10-5-2-6-11-18)27-24-19-14-20-12-7-13-21(15-19)25(20)16-17-8-3-1-4-9-17/h1-6,8-11,20-21H,7,12-16H2,(H,23,26).
What are the key properties of [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate?
[(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate has a molecular weight of 363.46 g/mol, XLogP of 4.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(9-benzyl-9-azabicyclo[3.3.1]nonan-3-ylidene)amino] N-phenylcarbamate is sourced from PubChem (CID 2822570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).