C17H16ClN5O — CID 2822615
4-[(2-chlorophenyl)methyl]-3,10,12-trimethyl-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one (PubChem CID 2822615) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-3,10,12-trimethyl-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one.
| Compound Name | 4-[(2-chlorophenyl)methyl]-3,10,12-trimethyl-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
|---|---|
| PubChem CID | 2822615 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-3,10,12-trimethyl-3,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-5-one |
| SMILES | Cc1nn(C)c2ncc3c(=O)n(Cc4ccccc4Cl)n(C)c3c12 |
| InChI | InChI=1S/C17H16ClN5O/c1-10-14-15-12(8-19-16(14)21(2)20-10)17(24)23(22(15)3)9-11-6-4-5-7-13(11)18/h4-8H,9H2,1-3H3 |
| InChIKey | XVBFQRPZTBMNIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |