About 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide (PubChem CID 2823392) has the molecular formula C16H16N2O3S2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
| PubChem CID | 2823392 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide |
| SMILES | O=C(CSc1nc2ccccc2o1)NCCSCc1ccco1 |
| InChI | InChI=1S/C16H16N2O3S2/c19-15(17-7-9-22-10-12-4-3-8-20-12)11-23-16-18-13-5-1-2-6-14(13)21-16/h1-6,8H,7,9-11H2,(H,17,19) |
| InChIKey | MBPGRIVYEDPPTM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide?
The IUPAC name of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide (CID 2823392) is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide.
What is the SMILES notation for 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide?
The canonical SMILES for 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide is O=C(CSc1nc2ccccc2o1)NCCSCc1ccco1.
What is the InChIKey of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide?
The InChIKey is MBPGRIVYEDPPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3S2/c19-15(17-7-9-22-10-12-4-3-8-20-12)11-23-16-18-13-5-1-2-6-14(13)21-16/h1-6,8H,7,9-11H2,(H,17,19).
What are the key properties of 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide?
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide has a molecular weight of 348.45 g/mol, XLogP of 3.56, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]acetamide is sourced from PubChem (CID 2823392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).