About 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline
6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline (PubChem CID 2823552) has the molecular formula C15H14N4S
and a molecular weight of 282.37 g/mol. Its IUPAC name is 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline.
Molecular Properties
| Compound Name | 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline |
| PubChem CID | 2823552 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline |
| SMILES | C=CCn1c(SC)nnc1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C15H14N4S/c1-3-9-19-14(17-18-15(19)20-2)12-6-7-13-11(10-12)5-4-8-16-13/h3-8,10H,1,9H2,2H3 |
| InChIKey | XLWOIYPFTPVDAA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline?
The IUPAC name of 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline (CID 2823552) is 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline.
What is the SMILES notation for 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline?
The canonical SMILES for 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline is C=CCn1c(SC)nnc1-c1ccc2ncccc2c1.
What is the InChIKey of 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline?
The InChIKey is XLWOIYPFTPVDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4S/c1-3-9-19-14(17-18-15(19)20-2)12-6-7-13-11(10-12)5-4-8-16-13/h3-8,10H,1,9H2,2H3.
What are the key properties of 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline?
6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline has a molecular weight of 282.37 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-methylsulfanyl-4-prop-2-enyl-1,2,4-triazol-3-yl)quinoline is sourced from PubChem (CID 2823552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).