C18H22N2O3S2 — CID 2823724
N-[[5-(cyclohexylsulfamoyl)thiophen-2-yl]methyl]benzamide (PubChem CID 2823724) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[[5-(cyclohexylsulfamoyl)thiophen-2-yl]methyl]benzamide.
| Compound Name | N-[[5-(cyclohexylsulfamoyl)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 2823724 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[[5-(cyclohexylsulfamoyl)thiophen-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)NC2CCCCC2)s1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3S2/c21-18(14-7-3-1-4-8-14)19-13-16-11-12-17(24-16)25(22,23)20-15-9-5-2-6-10-15/h1,3-4,7-8,11-12,15,20H,2,5-6,9-10,13H2,(H,19,21) |
| InChIKey | YYVDJLRXWKLDGX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |