About (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone
(4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone (PubChem CID 2823799) has the molecular formula C15H12ClNO2
and a molecular weight of 273.72 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
| PubChem CID | 2823799 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCOc2ccccc21 |
| InChI | InChI=1S/C15H12ClNO2/c16-12-7-5-11(6-8-12)15(18)17-9-10-19-14-4-2-1-3-13(14)17/h1-8H,9-10H2 |
| InChIKey | JVTOVFSJPOIMHA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
The IUPAC name of (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone (CID 2823799) is (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone.
What is the SMILES notation for (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
The canonical SMILES for (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone is O=C(c1ccc(Cl)cc1)N1CCOc2ccccc21.
What is the InChIKey of (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
The InChIKey is JVTOVFSJPOIMHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNO2/c16-12-7-5-11(6-8-12)15(18)17-9-10-19-14-4-2-1-3-13(14)17/h1-8H,9-10H2.
What are the key properties of (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone?
(4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone has a molecular weight of 273.72 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone is sourced from PubChem (CID 2823799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).