C15H10N4S — CID 2823823
N-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 2823823) has the molecular formula C15H10N4S and a molecular weight of 278.34 g/mol. Its IUPAC name is N-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | N-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 2823823 |
| Molecular Formula | C15H10N4S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | c1ccc(Nc2ncnc3c2sc2ncccc23)cc1 |
| InChI | InChI=1S/C15H10N4S/c1-2-5-10(6-3-1)19-14-13-12(17-9-18-14)11-7-4-8-16-15(11)20-13/h1-9H,(H,17,18,19) |
| InChIKey | JGUQMQCFPAZEKI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |