C14H9ClF2N2O2 — CID 2823829
N-[(4-chlorophenyl)carbamoyl]-2,4-difluorobenzamide (PubChem CID 2823829) has the molecular formula C14H9ClF2N2O2 and a molecular weight of 310.69 g/mol. Its IUPAC name is N-[(4-chlorophenyl)carbamoyl]-2,4-difluorobenzamide.
| Compound Name | N-[(4-chlorophenyl)carbamoyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 2823829 |
| Molecular Formula | C14H9ClF2N2O2 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-[(4-chlorophenyl)carbamoyl]-2,4-difluorobenzamide |
| SMILES | O=C(NC(=O)c1ccc(F)cc1F)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9ClF2N2O2/c15-8-1-4-10(5-2-8)18-14(21)19-13(20)11-6-3-9(16)7-12(11)17/h1-7H,(H2,18,19,20,21) |
| InChIKey | JUANCPYMKFWATC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |