C20H13ClN4O4S — CID 2823985
2-[[4-(2-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone (PubChem CID 2823985) has the molecular formula C20H13ClN4O4S and a molecular weight of 440.87 g/mol. Its IUPAC name is 2-[[4-(2-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[[4-(2-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 2823985 |
| Molecular Formula | C20H13ClN4O4S |
| Molecular Weight | 440.87 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-[[4-(2-chlorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(3-nitrophenyl)ethanone |
| SMILES | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13ClN4O4S/c21-15-7-1-2-8-16(15)24-19(18-9-4-10-29-18)22-23-20(24)30-12-17(26)13-5-3-6-14(11-13)25(27)28/h1-11H,12H2 |
| InChIKey | LFHDDIMVBLKWHG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 104.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.87 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|