About [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate
[1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate (PubChem CID 2824161) has the molecular formula C18H15ClN2O2S
and a molecular weight of 358.85 g/mol. Its IUPAC name is [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate.
Molecular Properties
| Compound Name | [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate |
| PubChem CID | 2824161 |
| Molecular Formula | C18H15ClN2O2S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate |
| SMILES | CC(=NOC(=O)Nc1ccccc1)c1sc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C18H15ClN2O2S/c1-11-15-10-13(19)8-9-16(15)24-17(11)12(2)21-23-18(22)20-14-6-4-3-5-7-14/h3-10H,1-2H3,(H,20,22) |
| InChIKey | CWCSYGXTXHVDIL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate?
The IUPAC name of [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate (CID 2824161) is [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate.
What is the SMILES notation for [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate?
The canonical SMILES for [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate is CC(=NOC(=O)Nc1ccccc1)c1sc2ccc(Cl)cc2c1C.
What is the InChIKey of [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate?
The InChIKey is CWCSYGXTXHVDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O2S/c1-11-15-10-13(19)8-9-16(15)24-17(11)12(2)21-23-18(22)20-14-6-4-3-5-7-14/h3-10H,1-2H3,(H,20,22).
What are the key properties of [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate?
[1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate has a molecular weight of 358.85 g/mol, XLogP of 5.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethylideneamino] N-phenylcarbamate is sourced from PubChem (CID 2824161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).