About phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate
phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate (PubChem CID 2824239) has the molecular formula C15H10N2O2S
and a molecular weight of 282.32 g/mol. Its IUPAC name is phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate |
| PubChem CID | 2824239 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(Oc1ccccc1)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C15H10N2O2S/c18-15(19-12-6-2-1-3-7-12)13-10-20-14(17-13)11-5-4-8-16-9-11/h1-10H |
| InChIKey | KXAJMOCCJGPWJZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate?
The IUPAC name of phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate (CID 2824239) is phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate?
The canonical SMILES for phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate is O=C(Oc1ccccc1)c1csc(-c2cccnc2)n1.
What is the InChIKey of phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate?
The InChIKey is KXAJMOCCJGPWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2S/c18-15(19-12-6-2-1-3-7-12)13-10-20-14(17-13)11-5-4-8-16-9-11/h1-10H.
What are the key properties of phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate?
phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate has a molecular weight of 282.32 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-pyridin-3-yl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 2824239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).