About 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea
1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea (PubChem CID 2824630) has the molecular formula C25H34N4O2S
and a molecular weight of 454.64 g/mol. Its IUPAC name is 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea.
Molecular Properties
| Compound Name | 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea |
| PubChem CID | 2824630 |
| Molecular Formula | C25H34N4O2S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea |
| SMILES | CC1CN(c2ccc(NC(=S)Nc3ccc(N4CC(C)OC(C)C4)cc3)cc2)CC(C)O1 |
| InChI | InChI=1S/C25H34N4O2S/c1-17-13-28(14-18(2)30-17)23-9-5-21(6-10-23)26-25(32)27-22-7-11-24(12-8-22)29-15-19(3)31-20(4)16-29/h5-12,17-20H,13-16H2,1-4H3,(H2,26,27,32) |
| InChIKey | ZUUYALVEELLHAA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea?
The IUPAC name of 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea (CID 2824630) is 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea.
What is the SMILES notation for 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea?
The canonical SMILES for 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea is CC1CN(c2ccc(NC(=S)Nc3ccc(N4CC(C)OC(C)C4)cc3)cc2)CC(C)O1.
What is the InChIKey of 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea?
The InChIKey is ZUUYALVEELLHAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N4O2S/c1-17-13-28(14-18(2)30-17)23-9-5-21(6-10-23)26-25(32)27-22-7-11-24(12-8-22)29-15-19(3)31-20(4)16-29/h5-12,17-20H,13-16H2,1-4H3,(H2,26,27,32).
What are the key properties of 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea?
1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea has a molecular weight of 454.64 g/mol, XLogP of 4.72, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[4-(2,6-dimethylmorpholin-4-yl)phenyl]thiourea is sourced from PubChem (CID 2824630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).