About 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide
1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide (PubChem CID 2824827) has the molecular formula C20H26N4O6
and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide.
Molecular Properties
| Compound Name | 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide |
| PubChem CID | 2824827 |
| Molecular Formula | C20H26N4O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide |
| SMILES | O=C(CCCCCCCCC(=O)NNC(=O)c1ccco1)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C20H26N4O6/c25-17(21-23-19(27)15-9-7-13-29-15)11-5-3-1-2-4-6-12-18(26)22-24-20(28)16-10-8-14-30-16/h7-10,13-14H,1-6,11-12H2,(H,21,25)(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | ZHJHVCLJVZKMFU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide?
The IUPAC name of 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide (CID 2824827) is 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide.
What is the SMILES notation for 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide?
The canonical SMILES for 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide is O=C(CCCCCCCCC(=O)NNC(=O)c1ccco1)NNC(=O)c1ccco1.
What is the InChIKey of 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide?
The InChIKey is ZHJHVCLJVZKMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O6/c25-17(21-23-19(27)15-9-7-13-29-15)11-5-3-1-2-4-6-12-18(26)22-24-20(28)16-10-8-14-30-16/h7-10,13-14H,1-6,11-12H2,(H,21,25)(H,22,26)(H,23,27)(H,24,28).
What are the key properties of 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide?
1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide has a molecular weight of 418.45 g/mol, XLogP of 2.22, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N',10-N'-bis(furan-2-carbonyl)decanedihydrazide is sourced from PubChem (CID 2824827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).