About 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea
1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea (PubChem CID 2825029) has the molecular formula C11H14Cl2N4S
and a molecular weight of 305.23 g/mol. Its IUPAC name is 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea.
Molecular Properties
| Compound Name | 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea |
| PubChem CID | 2825029 |
| Molecular Formula | C11H14Cl2N4S |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N=C(N)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N4S/c1-6(2)15-11(18)17-10(14)16-7-3-4-8(12)9(13)5-7/h3-6H,1-2H3,(H4,14,15,16,17,18) |
| InChIKey | LMGPKHNYVJMYNX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea?
The IUPAC name of 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea (CID 2825029) is 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea.
What is the SMILES notation for 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea?
The canonical SMILES for 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea is CC(C)NC(=S)N=C(N)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea?
The InChIKey is LMGPKHNYVJMYNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N4S/c1-6(2)15-11(18)17-10(14)16-7-3-4-8(12)9(13)5-7/h3-6H,1-2H3,(H4,14,15,16,17,18).
What are the key properties of 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea?
1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea has a molecular weight of 305.23 g/mol, XLogP of 3.00, 2 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[amino-(3,4-dichloroanilino)methylidene]-3-propan-2-ylthiourea is sourced from PubChem (CID 2825029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).