About 1-cyano-2,3-dicyclohexylguanidine
1-cyano-2,3-dicyclohexylguanidine (PubChem CID 2825084) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-cyano-2,3-dicyclohexylguanidine.
Molecular Properties
| Compound Name | 1-cyano-2,3-dicyclohexylguanidine |
| PubChem CID | 2825084 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-cyano-2,3-dicyclohexylguanidine |
| SMILES | N#CN/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C14H24N4/c15-11-16-14(17-12-7-3-1-4-8-12)18-13-9-5-2-6-10-13/h12-13H,1-10H2,(H2,16,17,18) |
| InChIKey | VKGAWIJMCJWARD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-2,3-dicyclohexylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-2,3-dicyclohexylguanidine?
The IUPAC name of 1-cyano-2,3-dicyclohexylguanidine (CID 2825084) is 1-cyano-2,3-dicyclohexylguanidine.
What is the SMILES notation for 1-cyano-2,3-dicyclohexylguanidine?
The canonical SMILES for 1-cyano-2,3-dicyclohexylguanidine is N#CN/C(=N\C1CCCCC1)NC1CCCCC1.
What is the InChIKey of 1-cyano-2,3-dicyclohexylguanidine?
The InChIKey is VKGAWIJMCJWARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4/c15-11-16-14(17-12-7-3-1-4-8-12)18-13-9-5-2-6-10-13/h12-13H,1-10H2,(H2,16,17,18).
What are the key properties of 1-cyano-2,3-dicyclohexylguanidine?
1-cyano-2,3-dicyclohexylguanidine has a molecular weight of 248.37 g/mol, XLogP of 2.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-2,3-dicyclohexylguanidine is sourced from PubChem (CID 2825084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).