C28H28N2O4 — CID 2825258
[(2S,3S)-1-cyclohexyl-3-(4-nitrophenyl)aziridin-2-yl]-(2-phenylmethoxyphenyl)methanone (PubChem CID 2825258) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is [(2S,3S)-1-cyclohexyl-3-(4-nitrophenyl)aziridin-2-yl]-(2-phenylmethoxyphenyl)methanone.
| Compound Name | [(2S,3S)-1-cyclohexyl-3-(4-nitrophenyl)aziridin-2-yl]-(2-phenylmethoxyphenyl)methanone |
|---|---|
| PubChem CID | 2825258 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [(2S,3S)-1-cyclohexyl-3-(4-nitrophenyl)aziridin-2-yl]-(2-phenylmethoxyphenyl)methanone |
| SMILES | O=C(c1ccccc1OCc1ccccc1)[C@@H]1[C@H](c2ccc([N+](=O)[O-])cc2)N1C1CCCCC1 |
| InChI | InChI=1S/C28H28N2O4/c31-28(24-13-7-8-14-25(24)34-19-20-9-3-1-4-10-20)27-26(29(27)22-11-5-2-6-12-22)21-15-17-23(18-16-21)30(32)33/h1,3-4,7-10,13-18,22,26-27H,2,5-6,11-12,19H2/t26-,27-,29?/m0/s1 |
| InChIKey | VTVQKFYMYPAQHR-DARYULOESA-N |
| XLogP | 6.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|