About 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide
4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide (PubChem CID 2825283) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide |
| PubChem CID | 2825283 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide |
| SMILES | CCc1c(C)[nH]c(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C11H18N2O/c1-6-9-7(2)10(12-8(9)3)11(14)13(4)5/h12H,6H2,1-5H3 |
| InChIKey | MCNDHWWSFSXHMJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide (CID 2825283) is 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide is CCc1c(C)[nH]c(C(=O)N(C)C)c1C.
What is the InChIKey of 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide?
The InChIKey is MCNDHWWSFSXHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-6-9-7(2)10(12-8(9)3)11(14)13(4)5/h12H,6H2,1-5H3.
What are the key properties of 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide?
4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide has a molecular weight of 194.28 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N,N,3,5-tetramethyl-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 2825283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).