About 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one
7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one (PubChem CID 2825367) has the molecular formula C27H20O2
and a molecular weight of 376.46 g/mol. Its IUPAC name is 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one.
Molecular Properties
| Compound Name | 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one |
| PubChem CID | 2825367 |
| Molecular Formula | C27H20O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one |
| SMILES | CC12OC(c3ccccc3)=CC(c3ccccc3)=C1C(c1ccccc1)=CC2=O |
| InChI | InChI=1S/C27H20O2/c1-27-25(28)18-23(20-13-7-3-8-14-20)26(27)22(19-11-5-2-6-12-19)17-24(29-27)21-15-9-4-10-16-21/h2-18H,1H3 |
| InChIKey | HGPNGXFIZUYUNC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one?
The IUPAC name of 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one (CID 2825367) is 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one.
What is the SMILES notation for 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one?
The canonical SMILES for 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one is CC12OC(c3ccccc3)=CC(c3ccccc3)=C1C(c1ccccc1)=CC2=O.
What is the InChIKey of 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one?
The InChIKey is HGPNGXFIZUYUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20O2/c1-27-25(28)18-23(20-13-7-3-8-14-20)26(27)22(19-11-5-2-6-12-19)17-24(29-27)21-15-9-4-10-16-21/h2-18H,1H3.
What are the key properties of 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one?
7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one has a molecular weight of 376.46 g/mol, XLogP of 5.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-methyl-2,4,5-triphenylcyclopenta[b]pyran-7-one is sourced from PubChem (CID 2825367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).