About 2-(4-fluorophenyl)-4,6-diphenylpyridine
2-(4-fluorophenyl)-4,6-diphenylpyridine (PubChem CID 2825414) has the molecular formula C23H16FN
and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,6-diphenylpyridine.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-4,6-diphenylpyridine |
| PubChem CID | 2825414 |
| Molecular Formula | C23H16FN |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(4-fluorophenyl)-4,6-diphenylpyridine |
| SMILES | Fc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H16FN/c24-21-13-11-19(12-14-21)23-16-20(17-7-3-1-4-8-17)15-22(25-23)18-9-5-2-6-10-18/h1-16H |
| InChIKey | ZDYBXWJFOZQNBZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluorophenyl)-4,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-4,6-diphenylpyridine?
The IUPAC name of 2-(4-fluorophenyl)-4,6-diphenylpyridine (CID 2825414) is 2-(4-fluorophenyl)-4,6-diphenylpyridine.
What is the SMILES notation for 2-(4-fluorophenyl)-4,6-diphenylpyridine?
The canonical SMILES for 2-(4-fluorophenyl)-4,6-diphenylpyridine is Fc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)n2)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-4,6-diphenylpyridine?
The InChIKey is ZDYBXWJFOZQNBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16FN/c24-21-13-11-19(12-14-21)23-16-20(17-7-3-1-4-8-17)15-22(25-23)18-9-5-2-6-10-18/h1-16H.
What are the key properties of 2-(4-fluorophenyl)-4,6-diphenylpyridine?
2-(4-fluorophenyl)-4,6-diphenylpyridine has a molecular weight of 325.39 g/mol, XLogP of 6.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-4,6-diphenylpyridine is sourced from PubChem (CID 2825414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).