C26H32O5S — CID 2825501
(13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl 4-methylbenzenesulfonate (PubChem CID 2825501) has the molecular formula C26H32O5S and a molecular weight of 456.60 g/mol. Its IUPAC name is (13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl 4-methylbenzenesulfonate.
| Compound Name | (13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2825501 |
| Molecular Formula | C26H32O5S |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-10-yl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC23CCC(=O)C=C2CCC2C4CCC(=O)C4(C)CCC23)cc1 |
| InChI | InChI=1S/C26H32O5S/c1-17-3-6-20(7-4-17)32(29,30)31-16-26-14-11-19(27)15-18(26)5-8-21-22-9-10-24(28)25(22,2)13-12-23(21)26/h3-4,6-7,15,21-23H,5,8-14,16H2,1-2H3 |
| InChIKey | JSEONXJKSHDLSE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|