C10H9Cl2N7 — CID 2825738
1-[(2,6-dichlorophenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-yl)guanidine (PubChem CID 2825738) has the molecular formula C10H9Cl2N7 and a molecular weight of 298.14 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-yl)guanidine.
| Compound Name | 1-[(2,6-dichlorophenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-yl)guanidine |
|---|---|
| PubChem CID | 2825738 |
| Molecular Formula | C10H9Cl2N7 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methylideneamino]-2-(1H-1,2,4-triazol-5-yl)guanidine |
| SMILES | NC(=Nc1ncn[nH]1)NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H9Cl2N7/c11-7-2-1-3-8(12)6(7)4-15-18-9(13)17-10-14-5-16-19-10/h1-5H,(H4,13,14,16,17,18,19) |
| InChIKey | DEGCAYBLZJBEMN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|